C23H26N4O3S — CID 170723245
(6aR,9R)-N'-(benzenesulfonyl)-N,7-dimethyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide (PubChem CID 170723245) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is (6aR,9R)-N'-(benzenesulfonyl)-N,7-dimethyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide.
| Compound Name | (6aR,9R)-N'-(benzenesulfonyl)-N,7-dimethyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide |
|---|---|
| PubChem CID | 170723245 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (6aR,9R)-N'-(benzenesulfonyl)-N,7-dimethyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide |
| SMILES | CN(NS(=O)(=O)c1ccccc1)C(=O)[C@@H]1C=C2c3cccc4c3C(CN4)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C23H26N4O3S/c1-26-14-16(23(28)27(2)25-31(29,30)17-7-4-3-5-8-17)11-19-18-9-6-10-20-22(18)15(13-24-20)12-21(19)26/h3-11,15-16,21,24-25H,12-14H2,1-2H3/t15?,16-,21-/m1/s1 |
| InChIKey | TXEPXCZNWYTGCO-VWDLYUFVSA-N |
| XLogP | 2.26 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|