C27H30Br2ClN — CID 170723459
2-bromo-N-(2-bromo-4-tert-butylphenyl)-5-tert-butyl-N-(4-chlorophenyl)-3-methylaniline (PubChem CID 170723459) has the molecular formula C27H30Br2ClN and a molecular weight of 563.81 g/mol. Its IUPAC name is 2-bromo-N-(2-bromo-4-tert-butylphenyl)-5-tert-butyl-N-(4-chlorophenyl)-3-methylaniline.
| Compound Name | 2-bromo-N-(2-bromo-4-tert-butylphenyl)-5-tert-butyl-N-(4-chlorophenyl)-3-methylaniline |
|---|---|
| PubChem CID | 170723459 |
| Molecular Formula | C27H30Br2ClN |
| Molecular Weight | 563.81 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 2-bromo-N-(2-bromo-4-tert-butylphenyl)-5-tert-butyl-N-(4-chlorophenyl)-3-methylaniline |
| SMILES | Cc1cc(C(C)(C)C)cc(N(c2ccc(Cl)cc2)c2ccc(C(C)(C)C)cc2Br)c1Br |
| InChI | InChI=1S/C27H30Br2ClN/c1-17-14-19(27(5,6)7)16-24(25(17)29)31(21-11-9-20(30)10-12-21)23-13-8-18(15-22(23)28)26(2,3)4/h8-16H,1-7H3 |
| InChIKey | ZQRIYWFRYSMRDP-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.81 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |