C26H27FN4O6 — CID 170724292
2-(ethylaminomethoxy)-N-[(6-fluoro-19-methoxy-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-10-yl)methyl]acetamide (PubChem CID 170724292) has the molecular formula C26H27FN4O6 and a molecular weight of 510.52 g/mol. Its IUPAC name is 2-(ethylaminomethoxy)-N-[(6-fluoro-19-methoxy-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-10-yl)methyl]acetamide.
| Compound Name | 2-(ethylaminomethoxy)-N-[(6-fluoro-19-methoxy-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-10-yl)methyl]acetamide |
|---|---|
| PubChem CID | 170724292 |
| Molecular Formula | C26H27FN4O6 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 2-(ethylaminomethoxy)-N-[(6-fluoro-19-methoxy-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-10-yl)methyl]acetamide |
| SMILES | CCNCOCC(=O)NCc1c2c(nc3cc(F)c(C)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3OC |
| InChI | InChI=1S/C26H27FN4O6/c1-4-28-12-36-11-22(32)29-8-16-14-5-13(2)19(27)7-20(14)30-23-17(16)9-31-21(23)6-15-18(25(31)33)10-37-26(34)24(15)35-3/h5-7,24,28H,4,8-12H2,1-3H3,(H,29,32) |
| InChIKey | RVPYRZDHAGTFCI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|