C24H23FN2O4 — CID 170745553
6-fluoro-10-(4-hydroxybutyl)-7,19-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 170745553) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is 6-fluoro-10-(4-hydroxybutyl)-7,19-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | 6-fluoro-10-(4-hydroxybutyl)-7,19-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 170745553 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 6-fluoro-10-(4-hydroxybutyl)-7,19-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | Cc1cc2c(CCCCO)c3c(nc2cc1F)-c1cc2c(c(=O)n1C3)COC(=O)C2C |
| InChI | InChI=1S/C24H23FN2O4/c1-12-7-16-14(5-3-4-6-28)17-10-27-21(22(17)26-20(16)9-19(12)25)8-15-13(2)24(30)31-11-18(15)23(27)29/h7-9,13,28H,3-6,10-11H2,1-2H3 |
| InChIKey | WCSDQYVOJMGVHH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|