C26H28BrFN2O3 — CID 170745529
10-(4-bromobutyl)-6-fluoro-7,19-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione;ethane (PubChem CID 170745529) has the molecular formula C26H28BrFN2O3 and a molecular weight of 515.42 g/mol. Its IUPAC name is 10-(4-bromobutyl)-6-fluoro-7,19-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione;ethane.
| Compound Name | 10-(4-bromobutyl)-6-fluoro-7,19-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione;ethane |
|---|---|
| PubChem CID | 170745529 |
| Molecular Formula | C26H28BrFN2O3 |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 10-(4-bromobutyl)-6-fluoro-7,19-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione;ethane |
| SMILES | CC.Cc1cc2c(CCCCBr)c3c(nc2cc1F)-c1cc2c(c(=O)n1C3)COC(=O)C2C |
| InChI | InChI=1S/C24H22BrFN2O3.C2H6/c1-12-7-16-14(5-3-4-6-25)17-10-28-21(22(17)27-20(16)9-19(12)26)8-15-13(2)24(30)31-11-18(15)23(28)29;1-2/h7-9,13H,3-6,10-11H2,1-2H3;1-2H3 |
| InChIKey | YSASSUUHDHKGNU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|