C14H22Cl2N4O — CID 170724571
6-chloro-5-(2-chloroethyl)-N-(2-methylpropyl)-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 170724571) has the molecular formula C14H22Cl2N4O and a molecular weight of 333.26 g/mol. Its IUPAC name is 6-chloro-5-(2-chloroethyl)-N-(2-methylpropyl)-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-(2-chloroethyl)-N-(2-methylpropyl)-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 170724571 |
| Molecular Formula | C14H22Cl2N4O |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 6-chloro-5-(2-chloroethyl)-N-(2-methylpropyl)-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | CC(C)CNc1nc(N2CCOCC2)nc(Cl)c1CCCl |
| InChI | InChI=1S/C14H22Cl2N4O/c1-10(2)9-17-13-11(3-4-15)12(16)18-14(19-13)20-5-7-21-8-6-20/h10H,3-9H2,1-2H3,(H,17,18,19) |
| InChIKey | PCQWEZZSUFKZCH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|