C28H31N7OS — CID 170725457
2-[3-(cyclopropyloxymethyl)phenyl]-N-[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]-[1,3]thiazolo[5,4-c]pyridin-6-amine (PubChem CID 170725457) has the molecular formula C28H31N7OS and a molecular weight of 513.67 g/mol. Its IUPAC name is 2-[3-(cyclopropyloxymethyl)phenyl]-N-[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]-[1,3]thiazolo[5,4-c]pyridin-6-amine.
| Compound Name | 2-[3-(cyclopropyloxymethyl)phenyl]-N-[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]-[1,3]thiazolo[5,4-c]pyridin-6-amine |
|---|---|
| PubChem CID | 170725457 |
| Molecular Formula | C28H31N7OS |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 2-[3-(cyclopropyloxymethyl)phenyl]-N-[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]-[1,3]thiazolo[5,4-c]pyridin-6-amine |
| SMILES | CCN1C[C@@H]2C[C@H]1CN2c1nc(C)cc(Nc2cc3nc(-c4cccc(COC5CC5)c4)sc3cn2)n1 |
| InChI | InChI=1S/C28H31N7OS/c1-3-34-14-21-11-20(34)15-35(21)28-30-17(2)9-26(33-28)32-25-12-23-24(13-29-25)37-27(31-23)19-6-4-5-18(10-19)16-36-22-7-8-22/h4-6,9-10,12-13,20-22H,3,7-8,11,14-16H2,1-2H3,(H,29,30,32,33)/t20-,21-/m0/s1 |
| InChIKey | DTFAIGQNTQPESX-SFTDATJTSA-N |
| XLogP | 5.16 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |