C29H34N8O3S — CID 171430553
3-[6-[[2-[(1S,4S)-5-[2-(2-hydroxyethoxy)ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]-N,N-dimethylbenzamide (PubChem CID 171430553) has the molecular formula C29H34N8O3S and a molecular weight of 574.71 g/mol. Its IUPAC name is 3-[6-[[2-[(1S,4S)-5-[2-(2-hydroxyethoxy)ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]-N,N-dimethylbenzamide.
| Compound Name | 3-[6-[[2-[(1S,4S)-5-[2-(2-hydroxyethoxy)ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 171430553 |
| Molecular Formula | C29H34N8O3S |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 3-[6-[[2-[(1S,4S)-5-[2-(2-hydroxyethoxy)ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]-N,N-dimethylbenzamide |
| SMILES | Cc1cc(Nc2cc3nc(-c4cccc(C(=O)N(C)C)c4)sc3cn2)nc(N2C[C@@H]3C[C@H]2CN3CCOCCO)n1 |
| InChI | InChI=1S/C29H34N8O3S/c1-18-11-26(34-29(31-18)37-17-21-13-22(37)16-36(21)7-9-40-10-8-38)33-25-14-23-24(15-30-25)41-27(32-23)19-5-4-6-20(12-19)28(39)35(2)3/h4-6,11-12,14-15,21-22,38H,7-10,13,16-17H2,1-3H3,(H,30,31,33,34)/t21-,22-/m0/s1 |
| InChIKey | DECHYZJGVKREHA-VXKWHMMOSA-N |
| XLogP | 3.17 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|