C16H21F3N4O — CID 170726493
ethane;(12S)-3,7,12-trimethyl-13-(2,2,2-trifluoroethyl)-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 170726493) has the molecular formula C16H21F3N4O and a molecular weight of 342.37 g/mol. Its IUPAC name is ethane;(12S)-3,7,12-trimethyl-13-(2,2,2-trifluoroethyl)-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | ethane;(12S)-3,7,12-trimethyl-13-(2,2,2-trifluoroethyl)-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 170726493 |
| Molecular Formula | C16H21F3N4O |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | ethane;(12S)-3,7,12-trimethyl-13-(2,2,2-trifluoroethyl)-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | CC.Cc1cc2nc(C)nc3c2c(n1)OC[C@H](C)N3CC(F)(F)F |
| InChI | InChI=1S/C14H15F3N4O.C2H6/c1-7-4-10-11-12(20-9(3)19-10)21(6-14(15,16)17)8(2)5-22-13(11)18-7;1-2/h4,8H,5-6H2,1-3H3;1-2H3/t8-;/m0./s1 |
| InChIKey | ZNFSUFDFXWOAHT-QRPNPIFTSA-N |
| XLogP | 3.82 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |