C33H38FNO5 — CID 170728363
4-[4-[2-(dimethoxymethyl)-7-azaspiro[3.5]nonan-7-yl]-5-fluoro-2-methoxyphenyl]-3-phenyl-3,4-dihydro-2H-chromen-7-ol (PubChem CID 170728363) has the molecular formula C33H38FNO5 and a molecular weight of 547.67 g/mol. Its IUPAC name is 4-[4-[2-(dimethoxymethyl)-7-azaspiro[3.5]nonan-7-yl]-5-fluoro-2-methoxyphenyl]-3-phenyl-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | 4-[4-[2-(dimethoxymethyl)-7-azaspiro[3.5]nonan-7-yl]-5-fluoro-2-methoxyphenyl]-3-phenyl-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 170728363 |
| Molecular Formula | C33H38FNO5 |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 4-[4-[2-(dimethoxymethyl)-7-azaspiro[3.5]nonan-7-yl]-5-fluoro-2-methoxyphenyl]-3-phenyl-3,4-dihydro-2H-chromen-7-ol |
| SMILES | COc1cc(N2CCC3(CC2)CC(C(OC)OC)C3)c(F)cc1C1c2ccc(O)cc2OCC1c1ccccc1 |
| InChI | InChI=1S/C33H38FNO5/c1-37-29-17-28(35-13-11-33(12-14-35)18-22(19-33)32(38-2)39-3)27(34)16-25(29)31-24-10-9-23(36)15-30(24)40-20-26(31)21-7-5-4-6-8-21/h4-10,15-17,22,26,31-32,36H,11-14,18-20H2,1-3H3 |
| InChIKey | XOFNEZBJPWTYEU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|