C18H22N2O5 — CID 170729665
tert-butyl N-[(4S,6S)-12-oxo-8,13-dioxa-2-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),10,15-trien-4-yl]carbamate (PubChem CID 170729665) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is tert-butyl N-[(4S,6S)-12-oxo-8,13-dioxa-2-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),10,15-trien-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,6S)-12-oxo-8,13-dioxa-2-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),10,15-trien-4-yl]carbamate |
|---|---|
| PubChem CID | 170729665 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | tert-butyl N-[(4S,6S)-12-oxo-8,13-dioxa-2-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),10,15-trien-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H]2COc3cc4c(cc3N2C1)COC4=O |
| InChI | InChI=1S/C18H22N2O5/c1-18(2,3)25-17(22)19-11-5-12-9-23-15-6-13-10(8-24-16(13)21)4-14(15)20(12)7-11/h4,6,11-12H,5,7-9H2,1-3H3,(H,19,22)/t11-,12-/m0/s1 |
| InChIKey | YWADQLIGBZGZDO-RYUDHWBXSA-N |
| XLogP | 2.22 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |