C39H55N3O4 — CID 170730004
N'-[(2R,4aS,6aR,6aS,14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-N,N'-dimethyloxamide (PubChem CID 170730004) has the molecular formula C39H55N3O4 and a molecular weight of 629.89 g/mol. Its IUPAC name is N'-[(2R,4aS,6aR,6aS,14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-N,N'-dimethyloxamide.
| Compound Name | N'-[(2R,4aS,6aR,6aS,14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-N,N'-dimethyloxamide |
|---|---|
| PubChem CID | 170730004 |
| Molecular Formula | C39H55N3O4 |
| Molecular Weight | 629.89 g/mol |
| Exact Mass | 629.42 |
| IUPAC Name | N'-[(2R,4aS,6aR,6aS,14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-N,N'-dimethyloxamide |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)C3C[C@](C)(N(C)C(=O)C(=O)N(C)[C@H]4CN5CCC4CC5)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C39H55N3O4/c1-24-26-9-10-30-37(4,27(26)21-29(43)32(24)44)16-18-39(6)31-22-36(3,15-13-35(31,2)14-17-38(30,39)5)41(8)34(46)33(45)40(7)28-23-42-19-11-25(28)12-20-42/h9-10,21,25,28,31,44H,11-20,22-23H2,1-8H3/t28-,31?,35+,36+,37-,38+,39-/m0/s1 |
| InChIKey | WKOGGJVUNVNNBQ-BJPMOMENSA-N |
| XLogP | 6.38 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.89 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|