C24H25N3O6S — CID 170731879
N-[2-(2,6-dioxocyclooctyl)-1-oxo-3H-isoindol-5-yl]-3-(methanesulfonamido)benzamide (PubChem CID 170731879) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is N-[2-(2,6-dioxocyclooctyl)-1-oxo-3H-isoindol-5-yl]-3-(methanesulfonamido)benzamide.
| Compound Name | N-[2-(2,6-dioxocyclooctyl)-1-oxo-3H-isoindol-5-yl]-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 170731879 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | N-[2-(2,6-dioxocyclooctyl)-1-oxo-3H-isoindol-5-yl]-3-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1cccc(C(=O)Nc2ccc3c(c2)CN(C2CCC(=O)CCCC2=O)C3=O)c1 |
| InChI | InChI=1S/C24H25N3O6S/c1-34(32,33)26-18-5-2-4-15(12-18)23(30)25-17-8-10-20-16(13-17)14-27(24(20)31)21-11-9-19(28)6-3-7-22(21)29/h2,4-5,8,10,12-13,21,26H,3,6-7,9,11,14H2,1H3,(H,25,30) |
| InChIKey | PNVHTBPDGUUWJA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |