C13H28N2 — CID 170732037
ethane;2-N-ethyl-3,4-dimethylpent-3-ene-1,2-diimine (PubChem CID 170732037) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is ethane;2-N-ethyl-3,4-dimethylpent-3-ene-1,2-diimine.
| Compound Name | ethane;2-N-ethyl-3,4-dimethylpent-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 170732037 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | ethane;2-N-ethyl-3,4-dimethylpent-3-ene-1,2-diimine |
| SMILES | CC.CC.[H]/N=C/C(=N\CC)C(C)=C(C)C |
| InChI | InChI=1S/C9H16N2.2C2H6/c1-5-11-9(6-10)8(4)7(2)3;2*1-2/h6,10H,5H2,1-4H3;2*1-2H3/b10-6+,11-9+;; |
| InChIKey | ZVYBSVYPPGHAOB-XPUPCMNESA-N |
| XLogP | 4.51 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|