C8H11F3N2 — CID 144910954
(2Z)-1-N-methyl-2-(1,1,1-trifluoropropan-2-ylidene)butane-1,3-diimine (PubChem CID 144910954) has the molecular formula C8H11F3N2 and a molecular weight of 192.18 g/mol. Its IUPAC name is (2Z)-1-N-methyl-2-(1,1,1-trifluoropropan-2-ylidene)butane-1,3-diimine.
| Compound Name | (2Z)-1-N-methyl-2-(1,1,1-trifluoropropan-2-ylidene)butane-1,3-diimine |
|---|---|
| PubChem CID | 144910954 |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (2Z)-1-N-methyl-2-(1,1,1-trifluoropropan-2-ylidene)butane-1,3-diimine |
| SMILES | [H]/N=C(C)/C(/C=N/C)=C(/C)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2/c1-5(8(9,10)11)7(4-13-3)6(2)12/h4,12H,1-3H3/b7-5-,12-6+,13-4+ |
| InChIKey | QOMXKDVVIKGYLR-YMXRGAKFSA-N |
| XLogP | 2.61 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|