C9H16N2 — CID 170732038
2-N-ethyl-3,4-dimethylpent-3-ene-1,2-diimine (PubChem CID 170732038) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-N-ethyl-3,4-dimethylpent-3-ene-1,2-diimine.
| Compound Name | 2-N-ethyl-3,4-dimethylpent-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 170732038 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-N-ethyl-3,4-dimethylpent-3-ene-1,2-diimine |
| SMILES | [H]/N=C/C(=N\CC)C(C)=C(C)C |
| InChI | InChI=1S/C9H16N2/c1-5-11-9(6-10)8(4)7(2)3/h6,10H,5H2,1-4H3/b10-6+,11-9+ |
| InChIKey | RLFUURSMIBAVNF-BBYAVRKXSA-N |
| XLogP | 2.45 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|