C14H14ClF3O5 — CID 170733210
2-chloro-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-(trifluoromethoxy)benzoic acid (PubChem CID 170733210) has the molecular formula C14H14ClF3O5 and a molecular weight of 354.71 g/mol. Its IUPAC name is 2-chloro-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-(trifluoromethoxy)benzoic acid.
| Compound Name | 2-chloro-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 170733210 |
| Molecular Formula | C14H14ClF3O5 |
| Molecular Weight | 354.71 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-chloro-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-(trifluoromethoxy)benzoic acid |
| SMILES | CC(C)(C)OC(=O)Cc1c(OC(F)(F)F)ccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C14H14ClF3O5/c1-13(2,3)23-10(19)6-8-9(22-14(16,17)18)5-4-7(11(8)15)12(20)21/h4-5H,6H2,1-3H3,(H,20,21) |
| InChIKey | MUFFHWVVRVBTCF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |