C11H5ClF3NO4 — CID 177043637
2-chloro-3-(1,3-oxazol-2-yl)-4-(trifluoromethoxy)benzoic acid (PubChem CID 177043637) has the molecular formula C11H5ClF3NO4 and a molecular weight of 307.61 g/mol. Its IUPAC name is 2-chloro-3-(1,3-oxazol-2-yl)-4-(trifluoromethoxy)benzoic acid.
| Compound Name | 2-chloro-3-(1,3-oxazol-2-yl)-4-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 177043637 |
| Molecular Formula | C11H5ClF3NO4 |
| Molecular Weight | 307.61 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-chloro-3-(1,3-oxazol-2-yl)-4-(trifluoromethoxy)benzoic acid |
| SMILES | O=C(O)c1ccc(OC(F)(F)F)c(-c2ncco2)c1Cl |
| InChI | InChI=1S/C11H5ClF3NO4/c12-8-5(10(17)18)1-2-6(20-11(13,14)15)7(8)9-16-3-4-19-9/h1-4H,(H,17,18) |
| InChIKey | HLGYTUONCNJUSN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |