C16H21ClF3NO4 — CID 67074007
tert-butyl 3-[3-chloro-N-(2-hydroxyethyl)-4-(trifluoromethoxy)anilino]propanoate (PubChem CID 67074007) has the molecular formula C16H21ClF3NO4 and a molecular weight of 383.79 g/mol. Its IUPAC name is tert-butyl 3-[3-chloro-N-(2-hydroxyethyl)-4-(trifluoromethoxy)anilino]propanoate.
| Compound Name | tert-butyl 3-[3-chloro-N-(2-hydroxyethyl)-4-(trifluoromethoxy)anilino]propanoate |
|---|---|
| PubChem CID | 67074007 |
| Molecular Formula | C16H21ClF3NO4 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | tert-butyl 3-[3-chloro-N-(2-hydroxyethyl)-4-(trifluoromethoxy)anilino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCN(CCO)c1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClF3NO4/c1-15(2,3)25-14(23)6-7-21(8-9-22)11-4-5-13(12(17)10-11)24-16(18,19)20/h4-5,10,22H,6-9H2,1-3H3 |
| InChIKey | JNKPTDUUCLUPDQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|