C29H38Cl4N2O6 — CID 160936553
tert-butyl 3-(3,4-dichloroanilino)propanoate;tert-butyl 3-(3,4-dichloro-N-(2-methoxy-2-oxoethyl)anilino)propanoate (PubChem CID 160936553) has the molecular formula C29H38Cl4N2O6 and a molecular weight of 652.44 g/mol. Its IUPAC name is tert-butyl 3-(3,4-dichloroanilino)propanoate;tert-butyl 3-(3,4-dichloro-N-(2-methoxy-2-oxoethyl)anilino)propanoate.
| Compound Name | tert-butyl 3-(3,4-dichloroanilino)propanoate;tert-butyl 3-(3,4-dichloro-N-(2-methoxy-2-oxoethyl)anilino)propanoate |
|---|---|
| PubChem CID | 160936553 |
| Molecular Formula | C29H38Cl4N2O6 |
| Molecular Weight | 652.44 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | tert-butyl 3-(3,4-dichloroanilino)propanoate;tert-butyl 3-(3,4-dichloro-N-(2-methoxy-2-oxoethyl)anilino)propanoate |
| SMILES | CC(C)(C)OC(=O)CCNc1ccc(Cl)c(Cl)c1.COC(=O)CN(CCC(=O)OC(C)(C)C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2NO4.C13H17Cl2NO2/c1-16(2,3)23-14(20)7-8-19(10-15(21)22-4)11-5-6-12(17)13(18)9-11;1-13(2,3)18-12(17)6-7-16-9-4-5-10(14)11(15)8-9/h5-6,9H,7-8,10H2,1-4H3;4-5,8,16H,6-7H2,1-3H3 |
| InChIKey | STYLFLRRKCAMPS-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.44 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|