C17H21ClF3NO5 — CID 67074409
tert-butyl 3-[3-chloro-N-(2-methoxy-2-oxoethyl)-4-(trifluoromethoxy)anilino]propanoate (PubChem CID 67074409) has the molecular formula C17H21ClF3NO5 and a molecular weight of 411.80 g/mol. Its IUPAC name is tert-butyl 3-[3-chloro-N-(2-methoxy-2-oxoethyl)-4-(trifluoromethoxy)anilino]propanoate.
| Compound Name | tert-butyl 3-[3-chloro-N-(2-methoxy-2-oxoethyl)-4-(trifluoromethoxy)anilino]propanoate |
|---|---|
| PubChem CID | 67074409 |
| Molecular Formula | C17H21ClF3NO5 |
| Molecular Weight | 411.80 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | tert-butyl 3-[3-chloro-N-(2-methoxy-2-oxoethyl)-4-(trifluoromethoxy)anilino]propanoate |
| SMILES | COC(=O)CN(CCC(=O)OC(C)(C)C)c1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C17H21ClF3NO5/c1-16(2,3)27-14(23)7-8-22(10-15(24)25-4)11-5-6-13(12(18)9-11)26-17(19,20)21/h5-6,9H,7-8,10H2,1-4H3 |
| InChIKey | SRVDIGFNMNTAQJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|