C17H24Cl3F3N2O5 — CID 86652691
3-[3-chloro-N-[2-[(4-methoxy-4-oxobutyl)amino]ethyl]-4-(trifluoromethoxy)anilino]propanoic acid;dihydrochloride (PubChem CID 86652691) has the molecular formula C17H24Cl3F3N2O5 and a molecular weight of 499.74 g/mol. Its IUPAC name is 3-[3-chloro-N-[2-[(4-methoxy-4-oxobutyl)amino]ethyl]-4-(trifluoromethoxy)anilino]propanoic acid;dihydrochloride.
| Compound Name | 3-[3-chloro-N-[2-[(4-methoxy-4-oxobutyl)amino]ethyl]-4-(trifluoromethoxy)anilino]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 86652691 |
| Molecular Formula | C17H24Cl3F3N2O5 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 3-[3-chloro-N-[2-[(4-methoxy-4-oxobutyl)amino]ethyl]-4-(trifluoromethoxy)anilino]propanoic acid;dihydrochloride |
| SMILES | COC(=O)CCCNCCN(CCC(=O)O)c1ccc(OC(F)(F)F)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C17H22ClF3N2O5.2ClH/c1-27-16(26)3-2-7-22-8-10-23(9-6-15(24)25)12-4-5-14(13(18)11-12)28-17(19,20)21;;/h4-5,11,22H,2-3,6-10H2,1H3,(H,24,25);2*1H |
| InChIKey | UVRILKWCQISMRJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|