C14H26N2O2 — CID 170737498
tert-butyl N-[4-[(1R,2S)-2-aminocyclopropyl]cyclohexyl]carbamate (PubChem CID 170737498) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is tert-butyl N-[4-[(1R,2S)-2-aminocyclopropyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1R,2S)-2-aminocyclopropyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 170737498 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | tert-butyl N-[4-[(1R,2S)-2-aminocyclopropyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC([C@H]2C[C@@H]2N)CC1 |
| InChI | InChI=1S/C14H26N2O2/c1-14(2,3)18-13(17)16-10-6-4-9(5-7-10)11-8-12(11)15/h9-12H,4-8,15H2,1-3H3,(H,16,17)/t9?,10?,11-,12+/m1/s1 |
| InChIKey | ABSCMLKTWJLFQJ-HCWSGVFWSA-N |
| XLogP | 2.42 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |