C18H32N4O3 — CID 170737723
tert-butyl 1-[(2R,5R)-5-azido-2-ethylhexanoyl]piperidine-4-carboxylate (PubChem CID 170737723) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl 1-[(2R,5R)-5-azido-2-ethylhexanoyl]piperidine-4-carboxylate.
| Compound Name | tert-butyl 1-[(2R,5R)-5-azido-2-ethylhexanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 170737723 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | tert-butyl 1-[(2R,5R)-5-azido-2-ethylhexanoyl]piperidine-4-carboxylate |
| SMILES | CC[C@H](CC[C@@H](C)N=[N+]=[N-])C(=O)N1CCC(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H32N4O3/c1-6-14(8-7-13(2)20-21-19)16(23)22-11-9-15(10-12-22)17(24)25-18(3,4)5/h13-15H,6-12H2,1-5H3/t13-,14-/m1/s1 |
| InChIKey | XGEFXXIUPBOJPR-ZIAGYGMSSA-N |
| XLogP | 4.07 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|