C19H33N5O5 — CID 59621009
ethyl 1-[(2S)-2-azido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-4-carboxylate (PubChem CID 59621009) has the molecular formula C19H33N5O5 and a molecular weight of 411.50 g/mol. Its IUPAC name is ethyl 1-[(2S)-2-azido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(2S)-2-azido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 59621009 |
| Molecular Formula | C19H33N5O5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | ethyl 1-[(2S)-2-azido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)[C@H](CCCCNC(=O)OC(C)(C)C)N=[N+]=[N-])CC1 |
| InChI | InChI=1S/C19H33N5O5/c1-5-28-17(26)14-9-12-24(13-10-14)16(25)15(22-23-20)8-6-7-11-21-18(27)29-19(2,3)4/h14-15H,5-13H2,1-4H3,(H,21,27)/t15-/m0/s1 |
| InChIKey | SYBKEPVRSGFPBL-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 133.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|