C22H30N2O7S — CID 170738909
4-hydroxy-6-[2-[2-(methanethioyloxymethyl)-5-[2-(propanoylamino)propanoylamino]phenyl]ethyl]oxane-2-carboxylic acid (PubChem CID 170738909) has the molecular formula C22H30N2O7S and a molecular weight of 466.56 g/mol. Its IUPAC name is 4-hydroxy-6-[2-[2-(methanethioyloxymethyl)-5-[2-(propanoylamino)propanoylamino]phenyl]ethyl]oxane-2-carboxylic acid.
| Compound Name | 4-hydroxy-6-[2-[2-(methanethioyloxymethyl)-5-[2-(propanoylamino)propanoylamino]phenyl]ethyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 170738909 |
| Molecular Formula | C22H30N2O7S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 4-hydroxy-6-[2-[2-(methanethioyloxymethyl)-5-[2-(propanoylamino)propanoylamino]phenyl]ethyl]oxane-2-carboxylic acid |
| SMILES | CCC(=O)NC(C)C(=O)Nc1ccc(COC=S)c(CCC2CC(O)CC(C(=O)O)O2)c1 |
| InChI | InChI=1S/C22H30N2O7S/c1-3-20(26)23-13(2)21(27)24-16-6-4-15(11-30-12-32)14(8-16)5-7-18-9-17(25)10-19(31-18)22(28)29/h4,6,8,12-13,17-19,25H,3,5,7,9-11H2,1-2H3,(H,23,26)(H,24,27)(H,28,29) |
| InChIKey | FLCTVMWDKUEMNS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|