C17H23NO5S — CID 145098333
4-hydroxy-6-[2-[2-(methanethioyloxymethyl)-5-(methylamino)phenyl]ethyl]oxane-2-carboxylic acid (PubChem CID 145098333) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-hydroxy-6-[2-[2-(methanethioyloxymethyl)-5-(methylamino)phenyl]ethyl]oxane-2-carboxylic acid.
| Compound Name | 4-hydroxy-6-[2-[2-(methanethioyloxymethyl)-5-(methylamino)phenyl]ethyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 145098333 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-hydroxy-6-[2-[2-(methanethioyloxymethyl)-5-(methylamino)phenyl]ethyl]oxane-2-carboxylic acid |
| SMILES | CNc1ccc(COC=S)c(CCC2CC(O)CC(C(=O)O)O2)c1 |
| InChI | InChI=1S/C17H23NO5S/c1-18-13-4-2-12(9-22-10-24)11(6-13)3-5-15-7-14(19)8-16(23-15)17(20)21/h2,4,6,10,14-16,18-19H,3,5,7-9H2,1H3,(H,20,21) |
| InChIKey | CMDVQCROORGRBC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|