C31H36N4O11 — CID 146474355
(6R)-6-[2-[5-[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]propanoylamino]-2-(formyloxymethyl)phenyl]ethynyl]-4-hydroxyoxane-2-carboxylic acid (PubChem CID 146474355) has the molecular formula C31H36N4O11 and a molecular weight of 640.65 g/mol. Its IUPAC name is (6R)-6-[2-[5-[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]propanoylamino]-2-(formyloxymethyl)phenyl]ethynyl]-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | (6R)-6-[2-[5-[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]propanoylamino]-2-(formyloxymethyl)phenyl]ethynyl]-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 146474355 |
| Molecular Formula | C31H36N4O11 |
| Molecular Weight | 640.65 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | (6R)-6-[2-[5-[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]propanoylamino]-2-(formyloxymethyl)phenyl]ethynyl]-4-hydroxyoxane-2-carboxylic acid |
| SMILES | CC(NC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)Nc1ccc(COC=O)c(C#C[C@H]2CC(O)CC(C(=O)O)O2)c1 |
| InChI | InChI=1S/C31H36N4O11/c1-19(33-27(39)16-32-26(38)5-3-2-4-12-35-28(40)10-11-29(35)41)30(42)34-22-8-6-21(17-45-18-36)20(13-22)7-9-24-14-23(37)15-25(46-24)31(43)44/h6,8,10-11,13,18-19,23-25,37H,2-5,12,14-17H2,1H3,(H,32,38)(H,33,39)(H,34,42)(H,43,44)/t19?,23?,24-,25?/m0/s1 |
| InChIKey | LNASTMYQEDUOPN-KIGUFTPJSA-N |
| XLogP | -0.25 |
| TPSA | 217.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.65 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|