C19H27NO7 — CID 171804662
4-hydroxy-6-[5-(propanoyloxymethyl)-2-(propan-2-ylamino)phenoxy]oxane-2-carboxylic acid (PubChem CID 171804662) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-hydroxy-6-[5-(propanoyloxymethyl)-2-(propan-2-ylamino)phenoxy]oxane-2-carboxylic acid.
| Compound Name | 4-hydroxy-6-[5-(propanoyloxymethyl)-2-(propan-2-ylamino)phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171804662 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-hydroxy-6-[5-(propanoyloxymethyl)-2-(propan-2-ylamino)phenoxy]oxane-2-carboxylic acid |
| SMILES | CCC(=O)OCc1ccc(NC(C)C)c(OC2CC(O)CC(C(=O)O)O2)c1 |
| InChI | InChI=1S/C19H27NO7/c1-4-17(22)25-10-12-5-6-14(20-11(2)3)15(7-12)26-18-9-13(21)8-16(27-18)19(23)24/h5-7,11,13,16,18,20-21H,4,8-10H2,1-3H3,(H,23,24) |
| InChIKey | OAEPZUUNWUZTEB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |