C16H22O5 — CID 164587803
4-hydroxy-6-(4-methyl-2-propan-2-ylphenoxy)oxane-2-carboxylic acid (PubChem CID 164587803) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-hydroxy-6-(4-methyl-2-propan-2-ylphenoxy)oxane-2-carboxylic acid.
| Compound Name | 4-hydroxy-6-(4-methyl-2-propan-2-ylphenoxy)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 164587803 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-hydroxy-6-(4-methyl-2-propan-2-ylphenoxy)oxane-2-carboxylic acid |
| SMILES | Cc1ccc(OC2CC(O)CC(C(=O)O)O2)c(C(C)C)c1 |
| InChI | InChI=1S/C16H22O5/c1-9(2)12-6-10(3)4-5-13(12)20-15-8-11(17)7-14(21-15)16(18)19/h4-6,9,11,14-15,17H,7-8H2,1-3H3,(H,18,19) |
| InChIKey | XAHIXXDHXMNNTD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |