C17H32N2O6 — CID 170739817
ethyl 2-methyl-3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]oxybutanoate (PubChem CID 170739817) has the molecular formula C17H32N2O6 and a molecular weight of 360.45 g/mol. Its IUPAC name is ethyl 2-methyl-3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]oxybutanoate.
| Compound Name | ethyl 2-methyl-3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]oxybutanoate |
|---|---|
| PubChem CID | 170739817 |
| Molecular Formula | C17H32N2O6 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | ethyl 2-methyl-3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]oxybutanoate |
| SMILES | CCOC(=O)C(C)C(C)ONC(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H32N2O6/c1-9-23-15(21)11(4)12(5)25-19-14(20)13(10(2)3)18-16(22)24-17(6,7)8/h10-13H,9H2,1-8H3,(H,18,22)(H,19,20) |
| InChIKey | GVMWNGKBRCLVAF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|