C11H13BrF3NO3S — CID 170743723
3-bromo-N-methyl-N-propyl-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 170743723) has the molecular formula C11H13BrF3NO3S and a molecular weight of 376.19 g/mol. Its IUPAC name is 3-bromo-N-methyl-N-propyl-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 3-bromo-N-methyl-N-propyl-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 170743723 |
| Molecular Formula | C11H13BrF3NO3S |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 3-bromo-N-methyl-N-propyl-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CCCN(C)S(=O)(=O)c1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H13BrF3NO3S/c1-3-6-16(2)20(17,18)8-4-5-10(9(12)7-8)19-11(13,14)15/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | DYTODOSLDDJWKC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |