C23H16F4N2O3S — CID 170745334
4-[(2-fluoro-6-hydroxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide (PubChem CID 170745334) has the molecular formula C23H16F4N2O3S and a molecular weight of 476.45 g/mol. Its IUPAC name is 4-[(2-fluoro-6-hydroxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide.
| Compound Name | 4-[(2-fluoro-6-hydroxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide |
|---|---|
| PubChem CID | 170745334 |
| Molecular Formula | C23H16F4N2O3S |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 4-[(2-fluoro-6-hydroxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide |
| SMILES | O=C(NCc1c(F)cc(F)cc1F)c1ccc2c(c1)SCC(=O)N2Cc1c(O)cccc1F |
| InChI | InChI=1S/C23H16F4N2O3S/c24-13-7-17(26)14(18(27)8-13)9-28-23(32)12-4-5-19-21(6-12)33-11-22(31)29(19)10-15-16(25)2-1-3-20(15)30/h1-8,30H,9-11H2,(H,28,32) |
| InChIKey | UHJIEUHCCRENEA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|