C29H28F4N2O3S — CID 170745434
4-[(2-fluoro-6-hexoxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide (PubChem CID 170745434) has the molecular formula C29H28F4N2O3S and a molecular weight of 560.61 g/mol. Its IUPAC name is 4-[(2-fluoro-6-hexoxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide.
| Compound Name | 4-[(2-fluoro-6-hexoxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide |
|---|---|
| PubChem CID | 170745434 |
| Molecular Formula | C29H28F4N2O3S |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 4-[(2-fluoro-6-hexoxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide |
| SMILES | CCCCCCOc1cccc(F)c1CN1C(=O)CSc2cc(C(=O)NCc3c(F)cc(F)cc3F)ccc21 |
| InChI | InChI=1S/C29H28F4N2O3S/c1-2-3-4-5-11-38-26-8-6-7-22(31)21(26)16-35-25-10-9-18(12-27(25)39-17-28(35)36)29(37)34-15-20-23(32)13-19(30)14-24(20)33/h6-10,12-14H,2-5,11,15-17H2,1H3,(H,34,37) |
| InChIKey | SRLLQCHEEYKPCS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|