C32H38ClFN2O4S — CID 170745392
4-[(2-chloro-3-decoxy-6-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-2-methyl-3-oxo-1,4-benzothiazine-7-carboxamide (PubChem CID 170745392) has the molecular formula C32H38ClFN2O4S and a molecular weight of 601.18 g/mol. Its IUPAC name is 4-[(2-chloro-3-decoxy-6-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-2-methyl-3-oxo-1,4-benzothiazine-7-carboxamide.
| Compound Name | 4-[(2-chloro-3-decoxy-6-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-2-methyl-3-oxo-1,4-benzothiazine-7-carboxamide |
|---|---|
| PubChem CID | 170745392 |
| Molecular Formula | C32H38ClFN2O4S |
| Molecular Weight | 601.18 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | 4-[(2-chloro-3-decoxy-6-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-2-methyl-3-oxo-1,4-benzothiazine-7-carboxamide |
| SMILES | CCCCCCCCCCOc1ccc(F)c(CN2C(=O)C(C)Sc3cc(C(=O)NCc4ccco4)ccc32)c1Cl |
| InChI | InChI=1S/C32H38ClFN2O4S/c1-3-4-5-6-7-8-9-10-17-40-28-16-14-26(34)25(30(28)33)21-36-27-15-13-23(19-29(27)41-22(2)32(36)38)31(37)35-20-24-12-11-18-39-24/h11-16,18-19,22H,3-10,17,20-21H2,1-2H3,(H,35,37) |
| InChIKey | SSINAWFXJCJDIK-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.18 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|