C34H37ClF4N2O3S — CID 170745428
4-[(2-chloro-3-decoxy-6-fluorophenyl)methyl]-2-methyl-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide (PubChem CID 170745428) has the molecular formula C34H37ClF4N2O3S and a molecular weight of 665.19 g/mol. Its IUPAC name is 4-[(2-chloro-3-decoxy-6-fluorophenyl)methyl]-2-methyl-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide.
| Compound Name | 4-[(2-chloro-3-decoxy-6-fluorophenyl)methyl]-2-methyl-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide |
|---|---|
| PubChem CID | 170745428 |
| Molecular Formula | C34H37ClF4N2O3S |
| Molecular Weight | 665.19 g/mol |
| Exact Mass | 664.21 |
| IUPAC Name | 4-[(2-chloro-3-decoxy-6-fluorophenyl)methyl]-2-methyl-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide |
| SMILES | CCCCCCCCCCOc1ccc(F)c(CN2C(=O)C(C)Sc3cc(C(=O)NCc4c(F)cc(F)cc4F)ccc32)c1Cl |
| InChI | InChI=1S/C34H37ClF4N2O3S/c1-3-4-5-6-7-8-9-10-15-44-30-14-12-26(37)25(32(30)35)20-41-29-13-11-22(16-31(29)45-21(2)34(41)43)33(42)40-19-24-27(38)17-23(36)18-28(24)39/h11-14,16-18,21H,3-10,15,19-20H2,1-2H3,(H,40,42) |
| InChIKey | SKIGUEVZZUSJIJ-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.19 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|