C28H25F5N2O3S — CID 170745379
4-[(2,6-difluoro-4-pentoxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide (PubChem CID 170745379) has the molecular formula C28H25F5N2O3S and a molecular weight of 564.58 g/mol. Its IUPAC name is 4-[(2,6-difluoro-4-pentoxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide.
| Compound Name | 4-[(2,6-difluoro-4-pentoxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide |
|---|---|
| PubChem CID | 170745379 |
| Molecular Formula | C28H25F5N2O3S |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 4-[(2,6-difluoro-4-pentoxyphenyl)methyl]-3-oxo-N-[(2,4,6-trifluorophenyl)methyl]-1,4-benzothiazine-7-carboxamide |
| SMILES | CCCCCOc1cc(F)c(CN2C(=O)CSc3cc(C(=O)NCc4c(F)cc(F)cc4F)ccc32)c(F)c1 |
| InChI | InChI=1S/C28H25F5N2O3S/c1-2-3-4-7-38-18-11-23(32)20(24(33)12-18)14-35-25-6-5-16(8-26(25)39-15-27(35)36)28(37)34-13-19-21(30)9-17(29)10-22(19)31/h5-6,8-12H,2-4,7,13-15H2,1H3,(H,34,37) |
| InChIKey | SUIHPJHRFPSCPA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|