C25H30N4O7 — CID 170745527
[[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]acetyl]amino]methyl acetate;9-(methoxymethyl)-9H-fluorene (PubChem CID 170745527) has the molecular formula C25H30N4O7 and a molecular weight of 498.54 g/mol. Its IUPAC name is [[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]acetyl]amino]methyl acetate;9-(methoxymethyl)-9H-fluorene.
| Compound Name | [[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]acetyl]amino]methyl acetate;9-(methoxymethyl)-9H-fluorene |
|---|---|
| PubChem CID | 170745527 |
| Molecular Formula | C25H30N4O7 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | [[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]acetyl]amino]methyl acetate;9-(methoxymethyl)-9H-fluorene |
| SMILES | CC(=O)OCNC(=O)CNC(=O)CNC(=O)CNC=O.COCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H14O.C10H16N4O6/c1-16-10-15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15;1-7(16)20-6-14-10(19)4-13-9(18)3-12-8(17)2-11-5-15/h2-9,15H,10H2,1H3;5H,2-4,6H2,1H3,(H,11,15)(H,12,17)(H,13,18)(H,14,19) |
| InChIKey | MLFBMYMFBAMSRI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|