C30H30FN7O2S — CID 170746710
1-[4-[4-[4-[(E)-1-amino-3-[(4-methyl-2-pyridinyl)methylimino]prop-1-enoxy]-2-fluoroanilino]thieno[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 170746710) has the molecular formula C30H30FN7O2S and a molecular weight of 571.68 g/mol. Its IUPAC name is 1-[4-[4-[4-[(E)-1-amino-3-[(4-methyl-2-pyridinyl)methylimino]prop-1-enoxy]-2-fluoroanilino]thieno[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[4-[(E)-1-amino-3-[(4-methyl-2-pyridinyl)methylimino]prop-1-enoxy]-2-fluoroanilino]thieno[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170746710 |
| Molecular Formula | C30H30FN7O2S |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 1-[4-[4-[4-[(E)-1-amino-3-[(4-methyl-2-pyridinyl)methylimino]prop-1-enoxy]-2-fluoroanilino]thieno[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(c2csc3ncnc(Nc4ccc(O/C(N)=C/C=N/Cc5cc(C)ccn5)cc4F)c23)CC1 |
| InChI | InChI=1S/C30H30FN7O2S/c1-3-27(39)38-12-8-20(9-13-38)23-17-41-30-28(23)29(35-18-36-30)37-25-5-4-22(15-24(25)31)40-26(32)7-10-33-16-21-14-19(2)6-11-34-21/h3-7,10-11,14-15,17-18,20H,1,8-9,12-13,16,32H2,2H3,(H,35,36,37)/b26-7+,33-10+ |
| InChIKey | RQWMKYJMRDAXNU-PMWPYTOESA-N |
| XLogP | 5.62 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|