C18H26N4O2S — CID 170747553
methanamine;6-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)thieno[2,3-b]pyridine-2-carbaldehyde (PubChem CID 170747553) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is methanamine;6-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)thieno[2,3-b]pyridine-2-carbaldehyde.
| Compound Name | methanamine;6-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)thieno[2,3-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 170747553 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | methanamine;6-(4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)thieno[2,3-b]pyridine-2-carbaldehyde |
| SMILES | CN.CN1CCOC2(CCN(c3ccc4cc(C=O)sc4n3)CC2)C1 |
| InChI | InChI=1S/C17H21N3O2S.CH5N/c1-19-8-9-22-17(12-19)4-6-20(7-5-17)15-3-2-13-10-14(11-21)23-16(13)18-15;1-2/h2-3,10-11H,4-9,12H2,1H3;2H2,1H3 |
| InChIKey | LVWFUZPHTIYFTI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|