C15H9BrClFN2O4 — CID 170750981
(5-bromo-7-nitro-3,4-dihydro-2H-1,4-benzoxazin-6-yl)-(2-chloro-5-fluorophenyl)methanone (PubChem CID 170750981) has the molecular formula C15H9BrClFN2O4 and a molecular weight of 415.60 g/mol. Its IUPAC name is (5-bromo-7-nitro-3,4-dihydro-2H-1,4-benzoxazin-6-yl)-(2-chloro-5-fluorophenyl)methanone.
| Compound Name | (5-bromo-7-nitro-3,4-dihydro-2H-1,4-benzoxazin-6-yl)-(2-chloro-5-fluorophenyl)methanone |
|---|---|
| PubChem CID | 170750981 |
| Molecular Formula | C15H9BrClFN2O4 |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | (5-bromo-7-nitro-3,4-dihydro-2H-1,4-benzoxazin-6-yl)-(2-chloro-5-fluorophenyl)methanone |
| SMILES | O=C(c1cc(F)ccc1Cl)c1c([N+](=O)[O-])cc2c(c1Br)NCCO2 |
| InChI | InChI=1S/C15H9BrClFN2O4/c16-13-12(15(21)8-5-7(18)1-2-9(8)17)10(20(22)23)6-11-14(13)19-3-4-24-11/h1-2,5-6,19H,3-4H2 |
| InChIKey | STVXEWINZRGBDR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|