C18H16BrClFN3O3 — CID 170750132
(7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane (PubChem CID 170750132) has the molecular formula C18H16BrClFN3O3 and a molecular weight of 456.70 g/mol. Its IUPAC name is (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane.
| Compound Name | (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane |
|---|---|
| PubChem CID | 170750132 |
| Molecular Formula | C18H16BrClFN3O3 |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane |
| SMILES | CC.Cc1c2cc([N+](=O)[O-])c(C(=O)c3cc(F)ccc3Cl)c(Br)c2nn1C |
| InChI | InChI=1S/C16H10BrClFN3O3.C2H6/c1-7-9-6-12(22(24)25)13(14(17)15(9)20-21(7)2)16(23)10-5-8(19)3-4-11(10)18;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | NQTGXIZOYKUNJP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|