About (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane
(7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane (PubChem CID 170750132) has the molecular formula C18H16BrClFN3O3
and a molecular weight of 456.70 g/mol. Its IUPAC name is (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane.
Molecular Properties
| Compound Name | (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane |
| PubChem CID | 170750132 |
| Molecular Formula | C18H16BrClFN3O3 |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane |
| SMILES | CC.Cc1c2cc([N+](=O)[O-])c(C(=O)c3cc(F)ccc3Cl)c(Br)c2nn1C |
| InChI | InChI=1S/C16H10BrClFN3O3.C2H6/c1-7-9-6-12(22(24)25)13(14(17)15(9)20-21(7)2)16(23)10-5-8(19)3-4-11(10)18;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | NQTGXIZOYKUNJP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane?
The IUPAC name of (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane (CID 170750132) is (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane.
What is the SMILES notation for (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane?
The canonical SMILES for (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane is CC.Cc1c2cc([N+](=O)[O-])c(C(=O)c3cc(F)ccc3Cl)c(Br)c2nn1C.
What is the InChIKey of (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane?
The InChIKey is NQTGXIZOYKUNJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BrClFN3O3.C2H6/c1-7-9-6-12(22(24)25)13(14(17)15(9)20-21(7)2)16(23)10-5-8(19)3-4-11(10)18;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane?
(7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane has a molecular weight of 456.70 g/mol, XLogP of 5.60, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-2,3-dimethyl-5-nitroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone;ethane is sourced from PubChem (CID 170750132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).