C14H9Br2FN2O3 — CID 177201953
(4-amino-2,6-dibromo-3-nitrophenyl)-(5-fluoro-2-methylphenyl)methanone (PubChem CID 177201953) has the molecular formula C14H9Br2FN2O3 and a molecular weight of 432.04 g/mol. Its IUPAC name is (4-amino-2,6-dibromo-3-nitrophenyl)-(5-fluoro-2-methylphenyl)methanone.
| Compound Name | (4-amino-2,6-dibromo-3-nitrophenyl)-(5-fluoro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 177201953 |
| Molecular Formula | C14H9Br2FN2O3 |
| Molecular Weight | 432.04 g/mol |
| Exact Mass | 429.90 |
| IUPAC Name | (4-amino-2,6-dibromo-3-nitrophenyl)-(5-fluoro-2-methylphenyl)methanone |
| SMILES | Cc1ccc(F)cc1C(=O)c1c(Br)cc(N)c([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C14H9Br2FN2O3/c1-6-2-3-7(17)4-8(6)14(20)11-9(15)5-10(18)13(12(11)16)19(21)22/h2-5H,18H2,1H3 |
| InChIKey | QKHRKSVOVHXAPN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.04 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|