C19H17Br2FN2O5 — CID 177201580
methyl 3-[3,5-dibromo-4-(5-fluoro-2-methylbenzoyl)-2-nitroanilino]butanoate (PubChem CID 177201580) has the molecular formula C19H17Br2FN2O5 and a molecular weight of 532.16 g/mol. Its IUPAC name is methyl 3-[3,5-dibromo-4-(5-fluoro-2-methylbenzoyl)-2-nitroanilino]butanoate.
| Compound Name | methyl 3-[3,5-dibromo-4-(5-fluoro-2-methylbenzoyl)-2-nitroanilino]butanoate |
|---|---|
| PubChem CID | 177201580 |
| Molecular Formula | C19H17Br2FN2O5 |
| Molecular Weight | 532.16 g/mol |
| Exact Mass | 529.95 |
| IUPAC Name | methyl 3-[3,5-dibromo-4-(5-fluoro-2-methylbenzoyl)-2-nitroanilino]butanoate |
| SMILES | COC(=O)CC(C)Nc1cc(Br)c(C(=O)c2cc(F)ccc2C)c(Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17Br2FN2O5/c1-9-4-5-11(22)7-12(9)19(26)16-13(20)8-14(18(17(16)21)24(27)28)23-10(2)6-15(25)29-3/h4-5,7-8,10,23H,6H2,1-3H3 |
| InChIKey | JHBDMNUXGLYLCX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.16 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|