C14H7Br2ClFNO3 — CID 170750903
(2-chloro-5-methylphenyl)-(2,6-dibromo-4-fluoro-3-nitrophenyl)methanone (PubChem CID 170750903) has the molecular formula C14H7Br2ClFNO3 and a molecular weight of 451.47 g/mol. Its IUPAC name is (2-chloro-5-methylphenyl)-(2,6-dibromo-4-fluoro-3-nitrophenyl)methanone.
| Compound Name | (2-chloro-5-methylphenyl)-(2,6-dibromo-4-fluoro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 170750903 |
| Molecular Formula | C14H7Br2ClFNO3 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 448.85 |
| IUPAC Name | (2-chloro-5-methylphenyl)-(2,6-dibromo-4-fluoro-3-nitrophenyl)methanone |
| SMILES | Cc1ccc(Cl)c(C(=O)c2c(Br)cc(F)c([N+](=O)[O-])c2Br)c1 |
| InChI | InChI=1S/C14H7Br2ClFNO3/c1-6-2-3-9(17)7(4-6)14(20)11-8(15)5-10(18)13(12(11)16)19(21)22/h2-5H,1H3 |
| InChIKey | BEIYOXNZCGHBFV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|