C16H12BrClFN3O3 — CID 170750523
(7-bromo-2,3-dimethyl-5-nitro-3,3a-dihydroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone (PubChem CID 170750523) has the molecular formula C16H12BrClFN3O3 and a molecular weight of 428.65 g/mol. Its IUPAC name is (7-bromo-2,3-dimethyl-5-nitro-3,3a-dihydroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone.
| Compound Name | (7-bromo-2,3-dimethyl-5-nitro-3,3a-dihydroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone |
|---|---|
| PubChem CID | 170750523 |
| Molecular Formula | C16H12BrClFN3O3 |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | (7-bromo-2,3-dimethyl-5-nitro-3,3a-dihydroindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone |
| SMILES | CC1C2C=C([N+](=O)[O-])C(C(=O)c3cc(F)ccc3Cl)=C(Br)C2=NN1C |
| InChI | InChI=1S/C16H12BrClFN3O3/c1-7-9-6-12(22(24)25)13(14(17)15(9)20-21(7)2)16(23)10-5-8(19)3-4-11(10)18/h3-7,9H,1-2H3 |
| InChIKey | UQUNRIPSRFQTSL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|