C16H12BrClFN3O — CID 170750187
(5-amino-7-bromo-2,3-dimethylindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone (PubChem CID 170750187) has the molecular formula C16H12BrClFN3O and a molecular weight of 396.65 g/mol. Its IUPAC name is (5-amino-7-bromo-2,3-dimethylindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone.
| Compound Name | (5-amino-7-bromo-2,3-dimethylindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone |
|---|---|
| PubChem CID | 170750187 |
| Molecular Formula | C16H12BrClFN3O |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | (5-amino-7-bromo-2,3-dimethylindazol-6-yl)-(2-chloro-5-fluorophenyl)methanone |
| SMILES | Cc1c2cc(N)c(C(=O)c3cc(F)ccc3Cl)c(Br)c2nn1C |
| InChI | InChI=1S/C16H12BrClFN3O/c1-7-9-6-12(20)13(14(17)15(9)21-22(7)2)16(23)10-5-8(19)3-4-11(10)18/h3-6H,20H2,1-2H3 |
| InChIKey | WBPUDSPIAJHMRC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|