C16H10ClFN4O — CID 170750034
5-amino-6-(2-chloro-5-fluorobenzoyl)-1-methylindazole-7-carbonitrile (PubChem CID 170750034) has the molecular formula C16H10ClFN4O and a molecular weight of 328.73 g/mol. Its IUPAC name is 5-amino-6-(2-chloro-5-fluorobenzoyl)-1-methylindazole-7-carbonitrile.
| Compound Name | 5-amino-6-(2-chloro-5-fluorobenzoyl)-1-methylindazole-7-carbonitrile |
|---|---|
| PubChem CID | 170750034 |
| Molecular Formula | C16H10ClFN4O |
| Molecular Weight | 328.73 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 5-amino-6-(2-chloro-5-fluorobenzoyl)-1-methylindazole-7-carbonitrile |
| SMILES | Cn1ncc2cc(N)c(C(=O)c3cc(F)ccc3Cl)c(C#N)c21 |
| InChI | InChI=1S/C16H10ClFN4O/c1-22-15-8(7-21-22)4-13(20)14(11(15)6-19)16(23)10-5-9(18)2-3-12(10)17/h2-5,7H,20H2,1H3 |
| InChIKey | ISKOWVCDFOYSFC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|