C15H9ClFN3O4S — CID 174313602
7-amino-6-(2-chloro-5-fluorobenzoyl)-2,2-dioxo-1H-4,2λ6,1-benzoxathiazine-5-carbonitrile (PubChem CID 174313602) has the molecular formula C15H9ClFN3O4S and a molecular weight of 381.77 g/mol. Its IUPAC name is 7-amino-6-(2-chloro-5-fluorobenzoyl)-2,2-dioxo-1H-4,2λ6,1-benzoxathiazine-5-carbonitrile.
| Compound Name | 7-amino-6-(2-chloro-5-fluorobenzoyl)-2,2-dioxo-1H-4,2λ6,1-benzoxathiazine-5-carbonitrile |
|---|---|
| PubChem CID | 174313602 |
| Molecular Formula | C15H9ClFN3O4S |
| Molecular Weight | 381.77 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 7-amino-6-(2-chloro-5-fluorobenzoyl)-2,2-dioxo-1H-4,2λ6,1-benzoxathiazine-5-carbonitrile |
| SMILES | N#Cc1c2c(cc(N)c1C(=O)c1cc(F)ccc1Cl)NS(=O)(=O)CO2 |
| InChI | InChI=1S/C15H9ClFN3O4S/c16-10-2-1-7(17)3-8(10)14(21)13-9(5-18)15-12(4-11(13)19)20-25(22,23)6-24-15/h1-4,20H,6,19H2 |
| InChIKey | SYVWOYREYPQGQQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.77 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|