C18H12ClFN4O — CID 170750331
5-amino-6-(2-chloro-5-fluorobenzoyl)-3-ethenyl-2-methylindazole-7-carbonitrile (PubChem CID 170750331) has the molecular formula C18H12ClFN4O and a molecular weight of 354.77 g/mol. Its IUPAC name is 5-amino-6-(2-chloro-5-fluorobenzoyl)-3-ethenyl-2-methylindazole-7-carbonitrile.
| Compound Name | 5-amino-6-(2-chloro-5-fluorobenzoyl)-3-ethenyl-2-methylindazole-7-carbonitrile |
|---|---|
| PubChem CID | 170750331 |
| Molecular Formula | C18H12ClFN4O |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 5-amino-6-(2-chloro-5-fluorobenzoyl)-3-ethenyl-2-methylindazole-7-carbonitrile |
| SMILES | C=Cc1c2cc(N)c(C(=O)c3cc(F)ccc3Cl)c(C#N)c2nn1C |
| InChI | InChI=1S/C18H12ClFN4O/c1-3-15-11-7-14(22)16(12(8-21)17(11)23-24(15)2)18(25)10-6-9(20)4-5-13(10)19/h3-7H,1,22H2,2H3 |
| InChIKey | WNBLNVUORQUSJD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|